C15H22N2O5S — CID 129488504
methyl 2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]acetate (PubChem CID 129488504) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]acetate.
| Compound Name | methyl 2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]acetate |
|---|---|
| PubChem CID | 129488504 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 2-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]acetate |
| SMILES | COC(=O)CNc1ccc(S(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-11-9-17(10-12(2)22-11)23(19,20)14-6-4-13(5-7-14)16-8-15(18)21-3/h4-7,11-12,16H,8-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | WVBWPBFJDPCBSV-VXGBXAGGSA-N |
| XLogP | 1.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |