C25H33N3O6S — CID 25346792
butyl 4-[[2-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]-2-oxoethyl]amino]benzoate (PubChem CID 25346792) has the molecular formula C25H33N3O6S and a molecular weight of 503.62 g/mol. Its IUPAC name is butyl 4-[[2-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]-2-oxoethyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 25346792 |
| Molecular Formula | C25H33N3O6S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | butyl 4-[[2-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylanilino]-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NCC(=O)Nc2ccc(S(=O)(=O)N3C[C@H](C)O[C@@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O6S/c1-4-5-14-33-25(30)20-6-8-21(9-7-20)26-15-24(29)27-22-10-12-23(13-11-22)35(31,32)28-16-18(2)34-19(3)17-28/h6-13,18-19,26H,4-5,14-17H2,1-3H3,(H,27,29)/t18-,19-/m0/s1 |
| InChIKey | WRDQFQNNBVHFNP-OALUTQOASA-N |
| XLogP | 3.49 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|