C21H25NO5S — CID 8764337
2-phenylethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 8764337) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-phenylethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | 2-phenylethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8764337 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-phenylethyl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)OCCc3ccccc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H25NO5S/c1-16-14-22(15-17(2)27-16)28(24,25)20-10-8-19(9-11-20)21(23)26-13-12-18-6-4-3-5-7-18/h3-11,16-17H,12-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | VIGLDBXNXILXON-IRXDYDNUSA-N |
| XLogP | 2.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |