C16H23NO5S — CID 46544170
propyl 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 46544170) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is propyl 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | propyl 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 46544170 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | propyl 3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | CCCOC(=O)c1cccc(S(=O)(=O)N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C16H23NO5S/c1-4-8-21-16(18)14-6-5-7-15(9-14)23(19,20)17-10-12(2)22-13(3)11-17/h5-7,9,12-13H,4,8,10-11H2,1-3H3 |
| InChIKey | ZPHXKOGATLBAPK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |