C19H28N2O6S — CID 8661075
[2-(butylamino)-2-oxoethyl] 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 8661075) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8661075 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | CCCCNC(=O)COC(=O)c1cccc(S(=O)(=O)N2C[C@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C19H28N2O6S/c1-4-5-9-20-18(22)13-26-19(23)16-7-6-8-17(10-16)28(24,25)21-11-14(2)27-15(3)12-21/h6-8,10,14-15H,4-5,9,11-13H2,1-3H3,(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | WDSAYJVYTFBMEJ-GJZGRUSLSA-N |
| XLogP | 1.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|