C23H34N2O6S — CID 25426326
[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 25426326) has the molecular formula C23H34N2O6S and a molecular weight of 466.60 g/mol. Its IUPAC name is [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 25426326 |
| Molecular Formula | C23H34N2O6S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C23H34N2O6S/c1-15-7-5-10-21(18(15)4)24-22(26)14-30-23(27)19-8-6-9-20(11-19)32(28,29)25-12-16(2)31-17(3)13-25/h6,8-9,11,15-18,21H,5,7,10,12-14H2,1-4H3,(H,24,26)/t15-,16-,17+,18+,21+/m1/s1 |
| InChIKey | BYLRACUWOMCBFA-QKIGPUQLSA-N |
| XLogP | 2.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |