C21H32N2O4S — CID 129376632
N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide (PubChem CID 129376632) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide.
| Compound Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 129376632 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[(1R,2S,3S)-2,3-dimethylcyclohexyl]-3-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzamide |
| SMILES | C[C@H]1[C@@H](C)CCC[C@H]1NC(=O)c1cccc(S(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C21H32N2O4S/c1-14-7-5-10-20(17(14)4)22-21(24)18-8-6-9-19(11-18)28(25,26)23-12-15(2)27-16(3)13-23/h6,8-9,11,14-17,20H,5,7,10,12-13H2,1-4H3,(H,22,24)/t14-,15+,16+,17-,20+/m0/s1 |
| InChIKey | VQDDBDIDHFCTEY-HAJKQMQPSA-N |
| XLogP | 3.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |