C23H28N2O4S — CID 26058274
3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 26058274) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 26058274 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(C(=O)N[C@H]3CCCc4ccccc43)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H28N2O4S/c1-16-14-25(15-17(2)29-16)30(27,28)20-10-5-9-19(13-20)23(26)24-22-12-6-8-18-7-3-4-11-21(18)22/h3-5,7,9-11,13,16-17,22H,6,8,12,14-15H2,1-2H3,(H,24,26)/t16-,17+,22-/m0/s1 |
| InChIKey | RLBAHLGZXBEFIN-JKSBSHDWSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |