C21H24ClNO6S — CID 26462444
2-(4-chlorophenoxy)ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 26462444) has the molecular formula C21H24ClNO6S and a molecular weight of 453.94 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 26462444 |
| Molecular Formula | C21H24ClNO6S |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cccc(C(=O)OCCOc3ccc(Cl)cc3)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C21H24ClNO6S/c1-15-13-23(14-16(2)29-15)30(25,26)20-5-3-4-17(12-20)21(24)28-11-10-27-19-8-6-18(22)7-9-19/h3-9,12,15-16H,10-11,13-14H2,1-2H3/t15-,16+ |
| InChIKey | CHFYNGRRTUUHPP-IYBDPMFKSA-N |
| XLogP | 3.37 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|