C21H25ClN2O5S — CID 43027985
N-[2-(4-chlorophenoxy)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 43027985) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43027985 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)NCCOc3ccc(Cl)cc3)c2)CC(C)O1 |
| InChI | InChI=1S/C21H25ClN2O5S/c1-15-13-24(14-16(2)29-15)30(26,27)20-5-3-4-17(12-20)21(25)23-10-11-28-19-8-6-18(22)7-9-19/h3-9,12,15-16H,10-11,13-14H2,1-2H3,(H,23,25) |
| InChIKey | MTGLMNJPQPSPEM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|