C19H22N2O5S — CID 94696380
4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-hydroxyphenyl)benzamide (PubChem CID 94696380) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-hydroxyphenyl)benzamide.
| Compound Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 94696380 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-hydroxyphenyl)benzamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(O)cc3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H22N2O5S/c1-13-11-21(12-14(2)26-13)27(24,25)18-9-3-15(4-10-18)19(23)20-16-5-7-17(22)8-6-16/h3-10,13-14,22H,11-12H2,1-2H3,(H,20,23)/t13-,14-/m1/s1 |
| InChIKey | CPUJUQXLNHYIMG-ZIAGYGMSSA-N |
| XLogP | 2.44 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|