C23H29N3O4S — CID 41170655
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 41170655) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 41170655 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-N-(4-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(N4CCCC4)cc3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C23H29N3O4S/c1-17-15-26(16-18(2)30-17)31(28,29)22-11-5-19(6-12-22)23(27)24-20-7-9-21(10-8-20)25-13-3-4-14-25/h5-12,17-18H,3-4,13-16H2,1-2H3,(H,24,27)/t17-,18-/m0/s1 |
| InChIKey | UXLZAPKNSZWIKK-ROUUACIJSA-N |
| XLogP | 3.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|