C15H18N2O6S — CID 168570251
dimethyl (E)-2-[4-(cyclopropylsulfamoyl)anilino]but-2-enedioate (PubChem CID 168570251) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(cyclopropylsulfamoyl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(cyclopropylsulfamoyl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570251 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | dimethyl (E)-2-[4-(cyclopropylsulfamoyl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)NC2CC2)cc1)C(=O)OC |
| InChI | InChI=1S/C15H18N2O6S/c1-22-14(18)9-13(15(19)23-2)16-10-5-7-12(8-6-10)24(20,21)17-11-3-4-11/h5-9,11,16-17H,3-4H2,1-2H3/b13-9+ |
| InChIKey | COOFIPKBHHXHPE-UKTHLTGXSA-N |
| XLogP | 0.77 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|