C13H16N4O6S — CID 168565933
dimethyl (E)-2-[4-(diaminomethylideneamino)sulfonylanilino]but-2-enedioate (PubChem CID 168565933) has the molecular formula C13H16N4O6S and a molecular weight of 356.36 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(diaminomethylideneamino)sulfonylanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(diaminomethylideneamino)sulfonylanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168565933 |
| Molecular Formula | C13H16N4O6S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | dimethyl (E)-2-[4-(diaminomethylideneamino)sulfonylanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(S(=O)(=O)N=C(N)N)cc1)C(=O)OC |
| InChI | InChI=1S/C13H16N4O6S/c1-22-11(18)7-10(12(19)23-2)16-8-3-5-9(6-4-8)24(20,21)17-13(14)15/h3-7,16H,1-2H3,(H4,14,15,17)/b10-7+ |
| InChIKey | WYTYAFBWKSWMKL-JXMROGBWSA-N |
| XLogP | -0.71 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|