C14H16N2O6 — CID 168570210
dimethyl (E)-2-[4-(2-amino-2-oxoethoxy)anilino]but-2-enedioate (PubChem CID 168570210) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(2-amino-2-oxoethoxy)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(2-amino-2-oxoethoxy)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570210 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | dimethyl (E)-2-[4-(2-amino-2-oxoethoxy)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(OCC(N)=O)cc1)C(=O)OC |
| InChI | InChI=1S/C14H16N2O6/c1-20-13(18)7-11(14(19)21-2)16-9-3-5-10(6-4-9)22-8-12(15)17/h3-7,16H,8H2,1-2H3,(H2,15,17)/b11-7+ |
| InChIKey | CHKWNPUZLLKALL-YRNVUSSQSA-N |
| XLogP | 0.19 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|