C14H14F3NO5 — CID 168568796
dimethyl (E)-2-[4-(2,2,2-trifluoroethoxy)anilino]but-2-enedioate (PubChem CID 168568796) has the molecular formula C14H14F3NO5 and a molecular weight of 333.26 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(2,2,2-trifluoroethoxy)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(2,2,2-trifluoroethoxy)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568796 |
| Molecular Formula | C14H14F3NO5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | dimethyl (E)-2-[4-(2,2,2-trifluoroethoxy)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(OCC(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C14H14F3NO5/c1-21-12(19)7-11(13(20)22-2)18-9-3-5-10(6-4-9)23-8-14(15,16)17/h3-7,18H,8H2,1-2H3/b11-7+ |
| InChIKey | FDCFKZULSDHLJS-YRNVUSSQSA-N |
| XLogP | 2.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|