C17H22FNO5 — CID 168567999
dimethyl (E)-2-[4-(2,2-dimethylpropoxy)-3-fluoroanilino]but-2-enedioate (PubChem CID 168567999) has the molecular formula C17H22FNO5 and a molecular weight of 339.36 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(2,2-dimethylpropoxy)-3-fluoroanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(2,2-dimethylpropoxy)-3-fluoroanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567999 |
| Molecular Formula | C17H22FNO5 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | dimethyl (E)-2-[4-(2,2-dimethylpropoxy)-3-fluoroanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(OCC(C)(C)C)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C17H22FNO5/c1-17(2,3)10-24-14-7-6-11(8-12(14)18)19-13(16(21)23-5)9-15(20)22-4/h6-9,19H,10H2,1-5H3/b13-9+ |
| InChIKey | IBLXMEXOFPITAG-UKTHLTGXSA-N |
| XLogP | 2.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|