C18H14BrF2NO5 — CID 168567355
dimethyl (E)-2-[3-bromo-4-(2,4-difluorophenoxy)anilino]but-2-enedioate (PubChem CID 168567355) has the molecular formula C18H14BrF2NO5 and a molecular weight of 442.21 g/mol. Its IUPAC name is dimethyl (E)-2-[3-bromo-4-(2,4-difluorophenoxy)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-bromo-4-(2,4-difluorophenoxy)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567355 |
| Molecular Formula | C18H14BrF2NO5 |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | dimethyl (E)-2-[3-bromo-4-(2,4-difluorophenoxy)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(Oc2ccc(F)cc2F)c(Br)c1)C(=O)OC |
| InChI | InChI=1S/C18H14BrF2NO5/c1-25-17(23)9-14(18(24)26-2)22-11-4-6-15(12(19)8-11)27-16-5-3-10(20)7-13(16)21/h3-9,22H,1-2H3/b14-9+ |
| InChIKey | ODZKVFCSAXXELW-NTEUORMPSA-N |
| XLogP | 4.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|