C18H14F2N2O7 — CID 168568157
dimethyl (E)-2-[3-(2,4-difluorophenoxy)-5-nitroanilino]but-2-enedioate (PubChem CID 168568157) has the molecular formula C18H14F2N2O7 and a molecular weight of 408.31 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(2,4-difluorophenoxy)-5-nitroanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(2,4-difluorophenoxy)-5-nitroanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568157 |
| Molecular Formula | C18H14F2N2O7 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | dimethyl (E)-2-[3-(2,4-difluorophenoxy)-5-nitroanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Oc2ccc(F)cc2F)cc([N+](=O)[O-])c1)C(=O)OC |
| InChI | InChI=1S/C18H14F2N2O7/c1-27-17(23)9-15(18(24)28-2)21-11-6-12(22(25)26)8-13(7-11)29-16-4-3-10(19)5-14(16)20/h3-9,21H,1-2H3/b15-9+ |
| InChIKey | QBRAORDJNFLZCM-OQLLNIDSSA-N |
| XLogP | 3.31 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|