C13H12N2O8 — CID 168566950
2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-nitrobenzoic acid (PubChem CID 168566950) has the molecular formula C13H12N2O8 and a molecular weight of 324.25 g/mol. Its IUPAC name is 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-nitrobenzoic acid.
| Compound Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 168566950 |
| Molecular Formula | C13H12N2O8 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-nitrobenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc([N+](=O)[O-])cc1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C13H12N2O8/c1-22-11(16)6-10(13(19)23-2)14-9-4-3-7(15(20)21)5-8(9)12(17)18/h3-6,14H,1-2H3,(H,17,18)/b10-6+ |
| InChIKey | CUUHXZSNRFEJPD-UXBLZVDNSA-N |
| XLogP | 0.93 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|