C14H15NO7 — CID 168569978
2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-methoxybenzoic acid (PubChem CID 168569978) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-methoxybenzoic acid.
| Compound Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 168569978 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-5-methoxybenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(OC)cc1C(=O)O)C(=O)OC |
| InChI | InChI=1S/C14H15NO7/c1-20-8-4-5-10(9(6-8)13(17)18)15-11(14(19)22-3)7-12(16)21-2/h4-7,15H,1-3H3,(H,17,18)/b11-7+ |
| InChIKey | REZKPKALGLMZBU-YRNVUSSQSA-N |
| XLogP | 1.04 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|