C13H13NO7 — CID 168565944
5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-hydroxybenzoic acid (PubChem CID 168565944) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168565944 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-hydroxybenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(O)c(C(=O)O)c1)C(=O)OC |
| InChI | InChI=1S/C13H13NO7/c1-20-11(16)6-9(13(19)21-2)14-7-3-4-10(15)8(5-7)12(17)18/h3-6,14-15H,1-2H3,(H,17,18)/b9-6+ |
| InChIKey | OCDIDZHFKJVDCK-RMKNXTFCSA-N |
| XLogP | 0.73 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|