C17H20N2O6 — CID 168570610
5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-pyrrolidin-1-ylbenzoic acid (PubChem CID 168570610) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-pyrrolidin-1-ylbenzoic acid.
| Compound Name | 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-pyrrolidin-1-ylbenzoic acid |
|---|---|
| PubChem CID | 168570610 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]-2-pyrrolidin-1-ylbenzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(N2CCCC2)c(C(=O)O)c1)C(=O)OC |
| InChI | InChI=1S/C17H20N2O6/c1-24-15(20)10-13(17(23)25-2)18-11-5-6-14(12(9-11)16(21)22)19-7-3-4-8-19/h5-6,9-10,18H,3-4,7-8H2,1-2H3,(H,21,22)/b13-10+ |
| InChIKey | IULJUNDDLVGZCJ-JLHYYAGUSA-N |
| XLogP | 1.63 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|