C18H23ClN2O4 — CID 168570701
dimethyl (E)-2-[3-chloro-4-(2-methylpiperidin-1-yl)anilino]but-2-enedioate (PubChem CID 168570701) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is dimethyl (E)-2-[3-chloro-4-(2-methylpiperidin-1-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-chloro-4-(2-methylpiperidin-1-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570701 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | dimethyl (E)-2-[3-chloro-4-(2-methylpiperidin-1-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(N2CCCCC2C)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C18H23ClN2O4/c1-12-6-4-5-9-21(12)16-8-7-13(10-14(16)19)20-15(18(23)25-3)11-17(22)24-2/h7-8,10-12,20H,4-6,9H2,1-3H3/b15-11+ |
| InChIKey | GCRJHDNCMGMOKD-RVDMUPIBSA-N |
| XLogP | 3.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|