C20H23Cl2N3O2 — CID 100803366
N-[3-amino-4-[(2S)-2-methylpiperidin-1-yl]phenyl]-3,5-dichloro-4-methoxybenzamide (PubChem CID 100803366) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[3-amino-4-[(2S)-2-methylpiperidin-1-yl]phenyl]-3,5-dichloro-4-methoxybenzamide.
| Compound Name | N-[3-amino-4-[(2S)-2-methylpiperidin-1-yl]phenyl]-3,5-dichloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 100803366 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[3-amino-4-[(2S)-2-methylpiperidin-1-yl]phenyl]-3,5-dichloro-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccc(N3CCCC[C@@H]3C)c(N)c2)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-12-5-3-4-8-25(12)18-7-6-14(11-17(18)23)24-20(26)13-9-15(21)19(27-2)16(22)10-13/h6-7,9-12H,3-5,8,23H2,1-2H3,(H,24,26)/t12-/m0/s1 |
| InChIKey | BVYLECSWOADGBE-LBPRGKRZSA-N |
| XLogP | 5.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|