C20H24BrN3O2 — CID 91676104
N-[3-amino-4-(2-methylpiperidin-1-yl)phenyl]-3-bromo-4-methoxybenzamide (PubChem CID 91676104) has the molecular formula C20H24BrN3O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is N-[3-amino-4-(2-methylpiperidin-1-yl)phenyl]-3-bromo-4-methoxybenzamide.
| Compound Name | N-[3-amino-4-(2-methylpiperidin-1-yl)phenyl]-3-bromo-4-methoxybenzamide |
|---|---|
| PubChem CID | 91676104 |
| Molecular Formula | C20H24BrN3O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[3-amino-4-(2-methylpiperidin-1-yl)phenyl]-3-bromo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCCCC3C)c(N)c2)cc1Br |
| InChI | InChI=1S/C20H24BrN3O2/c1-13-5-3-4-10-24(13)18-8-7-15(12-17(18)22)23-20(25)14-6-9-19(26-2)16(21)11-14/h6-9,11-13H,3-5,10,22H2,1-2H3,(H,23,25) |
| InChIKey | IJEDYRYQPQRSBY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|