C21H27N3O3 — CID 100803208
N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 100803208) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 100803208 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[5-amino-2-[(2R)-2-methylpiperidin-1-yl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(N)ccc2N2CCCC[C@H]2C)cc1OC |
| InChI | InChI=1S/C21H27N3O3/c1-14-6-4-5-11-24(14)18-9-8-16(22)13-17(18)23-21(25)15-7-10-19(26-2)20(12-15)27-3/h7-10,12-14H,4-6,11,22H2,1-3H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | SCZVVPWTVMRJPK-CQSZACIVSA-N |
| XLogP | 3.92 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|