C19H22IN3O — CID 100803229
N-[5-amino-2-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-iodobenzamide (PubChem CID 100803229) has the molecular formula C19H22IN3O and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[5-amino-2-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-iodobenzamide.
| Compound Name | N-[5-amino-2-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 100803229 |
| Molecular Formula | C19H22IN3O |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-[5-amino-2-[(2S)-2-methylpiperidin-1-yl]phenyl]-3-iodobenzamide |
| SMILES | C[C@H]1CCCCN1c1ccc(N)cc1NC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C19H22IN3O/c1-13-5-2-3-10-23(13)18-9-8-16(21)12-17(18)22-19(24)14-6-4-7-15(20)11-14/h4,6-9,11-13H,2-3,5,10,21H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | RVQGZNSEPJGBDJ-ZDUSSCGKSA-N |
| XLogP | 4.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|