C23H30ClN3O — CID 50881555
N-[4-amino-2-chloro-5-(2-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide (PubChem CID 50881555) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is N-[4-amino-2-chloro-5-(2-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-amino-2-chloro-5-(2-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 50881555 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[4-amino-2-chloro-5-(2-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide |
| SMILES | CC1CCCCN1c1cc(NC(=O)c2ccc(C(C)(C)C)cc2)c(Cl)cc1N |
| InChI | InChI=1S/C23H30ClN3O/c1-15-7-5-6-12-27(15)21-14-20(18(24)13-19(21)25)26-22(28)16-8-10-17(11-9-16)23(2,3)4/h8-11,13-15H,5-7,12,25H2,1-4H3,(H,26,28) |
| InChIKey | KDPGUHBRPSLFHR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|