C19H20Cl3N3O — CID 95733361
N-[4-amino-2-chloro-5-[(2R)-2-methylpiperidin-1-yl]phenyl]-2,5-dichlorobenzamide (PubChem CID 95733361) has the molecular formula C19H20Cl3N3O and a molecular weight of 412.75 g/mol. Its IUPAC name is N-[4-amino-2-chloro-5-[(2R)-2-methylpiperidin-1-yl]phenyl]-2,5-dichlorobenzamide.
| Compound Name | N-[4-amino-2-chloro-5-[(2R)-2-methylpiperidin-1-yl]phenyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 95733361 |
| Molecular Formula | C19H20Cl3N3O |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[4-amino-2-chloro-5-[(2R)-2-methylpiperidin-1-yl]phenyl]-2,5-dichlorobenzamide |
| SMILES | C[C@@H]1CCCCN1c1cc(NC(=O)c2cc(Cl)ccc2Cl)c(Cl)cc1N |
| InChI | InChI=1S/C19H20Cl3N3O/c1-11-4-2-3-7-25(11)18-10-17(15(22)9-16(18)23)24-19(26)13-8-12(20)5-6-14(13)21/h5-6,8-11H,2-4,7,23H2,1H3,(H,24,26)/t11-/m1/s1 |
| InChIKey | UQWNJKKUYGCWQG-LLVKDONJSA-N |
| XLogP | 5.86 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|