C19H21Cl2N3O — CID 95733324
N-[4-amino-2-chloro-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-2-chlorobenzamide (PubChem CID 95733324) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is N-[4-amino-2-chloro-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-2-chlorobenzamide.
| Compound Name | N-[4-amino-2-chloro-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 95733324 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[4-amino-2-chloro-5-[(2S)-2-methylpiperidin-1-yl]phenyl]-2-chlorobenzamide |
| SMILES | C[C@H]1CCCCN1c1cc(NC(=O)c2ccccc2Cl)c(Cl)cc1N |
| InChI | InChI=1S/C19H21Cl2N3O/c1-12-6-4-5-9-24(12)18-11-17(15(21)10-16(18)22)23-19(25)13-7-2-3-8-14(13)20/h2-3,7-8,10-12H,4-6,9,22H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | IPRFLHAPOAPIHW-LBPRGKRZSA-N |
| XLogP | 5.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|