C22H29ClN4O — CID 50881655
N-[4-amino-2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-4-tert-butylbenzamide (PubChem CID 50881655) has the molecular formula C22H29ClN4O and a molecular weight of 400.95 g/mol. Its IUPAC name is N-[4-amino-2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-amino-2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 50881655 |
| Molecular Formula | C22H29ClN4O |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[4-amino-2-chloro-5-(4-methylpiperazin-1-yl)phenyl]-4-tert-butylbenzamide |
| SMILES | CN1CCN(c2cc(NC(=O)c3ccc(C(C)(C)C)cc3)c(Cl)cc2N)CC1 |
| InChI | InChI=1S/C22H29ClN4O/c1-22(2,3)16-7-5-15(6-8-16)21(28)25-19-14-20(18(24)13-17(19)23)27-11-9-26(4)10-12-27/h5-8,13-14H,9-12,24H2,1-4H3,(H,25,28) |
| InChIKey | LDDYKQADRCKEFN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|