C18H19BrClN3O — CID 50881412
N-(4-amino-2-chloro-5-piperidin-1-ylphenyl)-4-bromobenzamide (PubChem CID 50881412) has the molecular formula C18H19BrClN3O and a molecular weight of 408.73 g/mol. Its IUPAC name is N-(4-amino-2-chloro-5-piperidin-1-ylphenyl)-4-bromobenzamide.
| Compound Name | N-(4-amino-2-chloro-5-piperidin-1-ylphenyl)-4-bromobenzamide |
|---|---|
| PubChem CID | 50881412 |
| Molecular Formula | C18H19BrClN3O |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-(4-amino-2-chloro-5-piperidin-1-ylphenyl)-4-bromobenzamide |
| SMILES | Nc1cc(Cl)c(NC(=O)c2ccc(Br)cc2)cc1N1CCCCC1 |
| InChI | InChI=1S/C18H19BrClN3O/c19-13-6-4-12(5-7-13)18(24)22-16-11-17(15(21)10-14(16)20)23-8-2-1-3-9-23/h4-7,10-11H,1-3,8-9,21H2,(H,22,24) |
| InChIKey | UNBXRCKBWGVKJP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|