C19H19BrN6O — CID 50777019
4-bromo-N-[2-piperidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 50777019) has the molecular formula C19H19BrN6O and a molecular weight of 427.31 g/mol. Its IUPAC name is 4-bromo-N-[2-piperidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 4-bromo-N-[2-piperidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50777019 |
| Molecular Formula | C19H19BrN6O |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-bromo-N-[2-piperidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cc(-n2cnnn2)ccc1N1CCCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN6O/c20-15-6-4-14(5-7-15)19(27)22-17-12-16(26-13-21-23-24-26)8-9-18(17)25-10-2-1-3-11-25/h4-9,12-13H,1-3,10-11H2,(H,22,27) |
| InChIKey | NRAYQLMDJIYXNH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|