C20H22N6O3 — CID 50776801
3,5-dimethoxy-N-[2-pyrrolidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 50776801) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-pyrrolidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-pyrrolidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50776801 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3,5-dimethoxy-N-[2-pyrrolidin-1-yl-5-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cc(-n3cnnn3)ccc2N2CCCC2)c1 |
| InChI | InChI=1S/C20H22N6O3/c1-28-16-9-14(10-17(12-16)29-2)20(27)22-18-11-15(26-13-21-23-24-26)5-6-19(18)25-7-3-4-8-25/h5-6,9-13H,3-4,7-8H2,1-2H3,(H,22,27) |
| InChIKey | DEJFOYLHVFERMA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|