C18H19FN2O2 — CID 113092344
N-(5-fluoro-2-pyrrolidin-1-ylphenyl)-4-methoxybenzamide (PubChem CID 113092344) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(5-fluoro-2-pyrrolidin-1-ylphenyl)-4-methoxybenzamide.
| Compound Name | N-(5-fluoro-2-pyrrolidin-1-ylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 113092344 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-(5-fluoro-2-pyrrolidin-1-ylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(F)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C18H19FN2O2/c1-23-15-7-4-13(5-8-15)18(22)20-16-12-14(19)6-9-17(16)21-10-2-3-11-21/h4-9,12H,2-3,10-11H2,1H3,(H,20,22) |
| InChIKey | RMMSQJNGRPDNQK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |