C25H25FN4O3 — CID 46326630
4-fluoro-N-[3-[(4-methoxyphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 46326630) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-fluoro-N-[3-[(4-methoxyphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[(4-methoxyphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 46326630 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-fluoro-N-[3-[(4-methoxyphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | COc1ccc(NC(=O)Nc2cc(NC(=O)c3ccc(F)cc3)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C25H25FN4O3/c1-33-21-11-8-19(9-12-21)28-25(32)29-22-16-20(10-13-23(22)30-14-2-3-15-30)27-24(31)17-4-6-18(26)7-5-17/h4-13,16H,2-3,14-15H2,1H3,(H,27,31)(H2,28,29,32) |
| InChIKey | NFLHXVYCQUYBDL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|