C26H28N4O2 — CID 46326445
N-[3-[(3,4-dimethylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 46326445) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[3-[(3,4-dimethylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | N-[3-[(3,4-dimethylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 46326445 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[3-[(3,4-dimethylphenyl)carbamoylamino]-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)Nc2cc(NC(=O)c3ccccc3)ccc2N2CCCC2)cc1C |
| InChI | InChI=1S/C26H28N4O2/c1-18-10-11-21(16-19(18)2)28-26(32)29-23-17-22(12-13-24(23)30-14-6-7-15-30)27-25(31)20-8-4-3-5-9-20/h3-5,8-13,16-17H,6-7,14-15H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | XQNSQYMWJPLMKU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|