C25H24N4O4 — CID 46326484
N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 46326484) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 46326484 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylcarbamoylamino)-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)Nc1cc(NC(=O)c2ccccc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C25H24N4O4/c30-24(17-6-2-1-3-7-17)26-18-8-10-21(29-12-4-5-13-29)20(14-18)28-25(31)27-19-9-11-22-23(15-19)33-16-32-22/h1-3,6-11,14-15H,4-5,12-13,16H2,(H,26,30)(H2,27,28,31) |
| InChIKey | QHWUOIZVFCVRIZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|