C15H12N2O4 — CID 35142870
N-(1,3-benzodioxol-5-ylcarbamoyl)benzamide (PubChem CID 35142870) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)benzamide |
|---|---|
| PubChem CID | 35142870 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)benzamide |
| SMILES | O=C(NC(=O)c1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O4/c18-14(10-4-2-1-3-5-10)17-15(19)16-11-6-7-12-13(8-11)21-9-20-12/h1-8H,9H2,(H2,16,17,18,19) |
| InChIKey | OSQJVMGNTLZXGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |