C14H10F2N2O3 — CID 6468432
1-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)urea (PubChem CID 6468432) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 6468432 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(3,4-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10F2N2O3/c15-10-3-1-8(5-11(10)16)17-14(19)18-9-2-4-12-13(6-9)21-7-20-12/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | SCUGSQMYKQENBJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |