C14H12FN3O3 — CID 10589488
1-(1,3-benzodioxol-5-yl)-3-(4-fluoroanilino)urea (PubChem CID 10589488) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-fluoroanilino)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-fluoroanilino)urea |
|---|---|
| PubChem CID | 10589488 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-fluoroanilino)urea |
| SMILES | O=C(NNc1ccc(F)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12FN3O3/c15-9-1-3-10(4-2-9)17-18-14(19)16-11-5-6-12-13(7-11)21-8-20-12/h1-7,17H,8H2,(H2,16,18,19) |
| InChIKey | WNFKNUSMSNNRGF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|