C14H12N2O4 — CID 14545057
1-(1,3-benzodioxol-5-yl)-3-(4-hydroxyphenyl)urea (PubChem CID 14545057) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 14545057 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O4/c17-11-4-1-9(2-5-11)15-14(18)16-10-3-6-12-13(7-10)20-8-19-12/h1-7,17H,8H2,(H2,15,16,18) |
| InChIKey | QXEWFOHLVCPOKJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|