C14H12N2O6S — CID 108893705
4-(1,3-benzodioxol-5-ylcarbamoylamino)benzenesulfonic acid (PubChem CID 108893705) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylcarbamoylamino)benzenesulfonic acid.
| Compound Name | 4-(1,3-benzodioxol-5-ylcarbamoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 108893705 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylcarbamoylamino)benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O6S/c17-14(15-9-1-4-11(5-2-9)23(18,19)20)16-10-3-6-12-13(7-10)22-8-21-12/h1-7H,8H2,(H2,15,16,17)(H,18,19,20) |
| InChIKey | XKFWHWFGYBAQFG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|