C17H14N2O4 — CID 164948255
1-(1,3-benzodioxol-5-yl)-3-(2-oxo-1,3-dihydroinden-5-yl)urea (PubChem CID 164948255) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2-oxo-1,3-dihydroinden-5-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2-oxo-1,3-dihydroinden-5-yl)urea |
|---|---|
| PubChem CID | 164948255 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2-oxo-1,3-dihydroinden-5-yl)urea |
| SMILES | O=C1Cc2ccc(NC(=O)Nc3ccc4c(c3)OCO4)cc2C1 |
| InChI | InChI=1S/C17H14N2O4/c20-14-6-10-1-2-12(5-11(10)7-14)18-17(21)19-13-3-4-15-16(8-13)23-9-22-15/h1-5,8H,6-7,9H2,(H2,18,19,21) |
| InChIKey | AEFACGFHWIUDKP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |