C15H11N3O3 — CID 46860052
1-(1,3-benzodioxol-5-yl)-3-(4-cyanophenyl)urea (PubChem CID 46860052) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-cyanophenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-cyanophenyl)urea |
|---|---|
| PubChem CID | 46860052 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-cyanophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H11N3O3/c16-8-10-1-3-11(4-2-10)17-15(19)18-12-5-6-13-14(7-12)21-9-20-13/h1-7H,9H2,(H2,17,18,19) |
| InChIKey | NRWJIHWFDKNUNL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |