C21H14N4O4 — CID 109109030
5-N-(1,3-benzodioxol-5-yl)-3-N-(4-cyanophenyl)pyridine-3,5-dicarboxamide (PubChem CID 109109030) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-N-(1,3-benzodioxol-5-yl)-3-N-(4-cyanophenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(1,3-benzodioxol-5-yl)-3-N-(4-cyanophenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109109030 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-N-(1,3-benzodioxol-5-yl)-3-N-(4-cyanophenyl)pyridine-3,5-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cncc(C(=O)Nc3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C21H14N4O4/c22-9-13-1-3-16(4-2-13)24-20(26)14-7-15(11-23-10-14)21(27)25-17-5-6-18-19(8-17)29-12-28-18/h1-8,10-11H,12H2,(H,24,26)(H,25,27) |
| InChIKey | TWACTINKTQHTIC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |