C21H17N3O5 — CID 109245974
methyl 4-[[5-(1,3-benzodioxol-5-ylcarbamoyl)-3-pyridinyl]amino]benzoate (PubChem CID 109245974) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is methyl 4-[[5-(1,3-benzodioxol-5-ylcarbamoyl)-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(1,3-benzodioxol-5-ylcarbamoyl)-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109245974 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | methyl 4-[[5-(1,3-benzodioxol-5-ylcarbamoyl)-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cncc(C(=O)Nc3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C21H17N3O5/c1-27-21(26)13-2-4-15(5-3-13)23-17-8-14(10-22-11-17)20(25)24-16-6-7-18-19(9-16)29-12-28-18/h2-11,23H,12H2,1H3,(H,24,25) |
| InChIKey | FYTCWDLASXVVIM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |