C21H19N3O5 — CID 109245661
N-(1,3-benzodioxol-5-yl)-5-(2,4-dimethoxyanilino)pyridine-3-carboxamide (PubChem CID 109245661) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(2,4-dimethoxyanilino)pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(2,4-dimethoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109245661 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(2,4-dimethoxyanilino)pyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2cncc(C(=O)Nc3ccc4c(c3)OCO4)c2)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O5/c1-26-16-4-5-17(19(9-16)27-2)23-15-7-13(10-22-11-15)21(25)24-14-3-6-18-20(8-14)29-12-28-18/h3-11,23H,12H2,1-2H3,(H,24,25) |
| InChIKey | SRIPPNXYBCPLCJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |