C17H19N3O3 — CID 109225469
N-(1,3-benzodioxol-5-yl)-5-(butan-2-ylamino)pyridine-3-carboxamide (PubChem CID 109225469) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(butan-2-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(butan-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109225469 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(butan-2-ylamino)pyridine-3-carboxamide |
| SMILES | CCC(C)Nc1cncc(C(=O)Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-3-11(2)19-14-6-12(8-18-9-14)17(21)20-13-4-5-15-16(7-13)23-10-22-15/h4-9,11,19H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | HQEDJFKIPBWGSN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |